C17H25ClN4O2 — CID 119509580
N-[2-(ethylamino)ethyl]-4-hydroxy-1-(4-propan-2-ylphenyl)pyrazole-3-carboxamide;hydrochloride (PubChem CID 119509580) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-4-hydroxy-1-(4-propan-2-ylphenyl)pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-4-hydroxy-1-(4-propan-2-ylphenyl)pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119509580 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-4-hydroxy-1-(4-propan-2-ylphenyl)pyrazole-3-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1nn(-c2ccc(C(C)C)cc2)cc1O.Cl |
| InChI | InChI=1S/C17H24N4O2.ClH/c1-4-18-9-10-19-17(23)16-15(22)11-21(20-16)14-7-5-13(6-8-14)12(2)3;/h5-8,11-12,18,22H,4,9-10H2,1-3H3,(H,19,23);1H |
| InChIKey | RDHYMHUNIZVKND-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|