C26H30FN5O2 — CID 11951231
8-[4-[4-(7-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydropyrido[2,3-d][1,3]diazepin-2-one (PubChem CID 11951231) has the molecular formula C26H30FN5O2 and a molecular weight of 463.56 g/mol. Its IUPAC name is 8-[4-[4-(7-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydropyrido[2,3-d][1,3]diazepin-2-one.
| Compound Name | 8-[4-[4-(7-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydropyrido[2,3-d][1,3]diazepin-2-one |
|---|---|
| PubChem CID | 11951231 |
| Molecular Formula | C26H30FN5O2 |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 8-[4-[4-(7-fluoronaphthalen-1-yl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydropyrido[2,3-d][1,3]diazepin-2-one |
| SMILES | O=C1NCCc2ccc(OCCCCN3CCN(c4cccc5ccc(F)cc45)CC3)nc2N1 |
| InChI | InChI=1S/C26H30FN5O2/c27-21-8-6-19-4-3-5-23(22(19)18-21)32-15-13-31(14-16-32)12-1-2-17-34-24-9-7-20-10-11-28-26(33)30-25(20)29-24/h3-9,18H,1-2,10-17H2,(H2,28,29,30,33) |
| InChIKey | XBWYOLGEGJFFRN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|