C25H32F3N5O3 — CID 11951252
5-nitro-4-N-[[4-(pyrrolidin-1-ylmethyl)cyclohexyl]methyl]-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine (PubChem CID 11951252) has the molecular formula C25H32F3N5O3 and a molecular weight of 507.56 g/mol. Its IUPAC name is 5-nitro-4-N-[[4-(pyrrolidin-1-ylmethyl)cyclohexyl]methyl]-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine.
| Compound Name | 5-nitro-4-N-[[4-(pyrrolidin-1-ylmethyl)cyclohexyl]methyl]-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 11951252 |
| Molecular Formula | C25H32F3N5O3 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 5-nitro-4-N-[[4-(pyrrolidin-1-ylmethyl)cyclohexyl]methyl]-2-N-[[2-(trifluoromethoxy)phenyl]methyl]pyridine-2,4-diamine |
| SMILES | O=[N+]([O-])c1cnc(NCc2ccccc2OC(F)(F)F)cc1NCC1CCC(CN2CCCC2)CC1 |
| InChI | InChI=1S/C25H32F3N5O3/c26-25(27,28)36-23-6-2-1-5-20(23)15-30-24-13-21(22(16-31-24)33(34)35)29-14-18-7-9-19(10-8-18)17-32-11-3-4-12-32/h1-2,5-6,13,16,18-19H,3-4,7-12,14-15,17H2,(H2,29,30,31) |
| InChIKey | LPBKMEMRIIRTMK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|