C21H25ClN2O4 — CID 11951302
5-(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide (PubChem CID 11951302) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11951302 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[(1R,2R)-2-hydroxycyclohexyl]-6-(2-methoxyethoxy)pyridine-3-carboxamide |
| SMILES | COCCOc1ncc(C(=O)N[C@@H]2CCCC[C@H]2O)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2O4/c1-27-10-11-28-21-17(14-6-8-16(22)9-7-14)12-15(13-23-21)20(26)24-18-4-2-3-5-19(18)25/h6-9,12-13,18-19,25H,2-5,10-11H2,1H3,(H,24,26)/t18-,19-/m1/s1 |
| InChIKey | NWVOYLYQWIHTSN-RTBURBONSA-N |
| XLogP | 3.46 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|