C14H21ClN2O3S — CID 119513194
2-ethylsulfonyl-N-(pyrrolidin-2-ylmethyl)benzamide;hydrochloride (PubChem CID 119513194) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-(pyrrolidin-2-ylmethyl)benzamide;hydrochloride.
| Compound Name | 2-ethylsulfonyl-N-(pyrrolidin-2-ylmethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119513194 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-ethylsulfonyl-N-(pyrrolidin-2-ylmethyl)benzamide;hydrochloride |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)NCC1CCCN1.Cl |
| InChI | InChI=1S/C14H20N2O3S.ClH/c1-2-20(18,19)13-8-4-3-7-12(13)14(17)16-10-11-6-5-9-15-11;/h3-4,7-8,11,15H,2,5-6,9-10H2,1H3,(H,16,17);1H |
| InChIKey | QZXIILNJDOKJAW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |