C16H19ClN2O — CID 119514272
N-(pyrrolidin-2-ylmethyl)naphthalene-2-carboxamide;hydrochloride (PubChem CID 119514272) has the molecular formula C16H19ClN2O and a molecular weight of 290.79 g/mol. Its IUPAC name is N-(pyrrolidin-2-ylmethyl)naphthalene-2-carboxamide;hydrochloride.
| Compound Name | N-(pyrrolidin-2-ylmethyl)naphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119514272 |
| Molecular Formula | C16H19ClN2O |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-(pyrrolidin-2-ylmethyl)naphthalene-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CCCN1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H18N2O.ClH/c19-16(18-11-15-6-3-9-17-15)14-8-7-12-4-1-2-5-13(12)10-14;/h1-2,4-5,7-8,10,15,17H,3,6,9,11H2,(H,18,19);1H |
| InChIKey | HDWICEBNZDOYOO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |