C23H28ClFN4O2 — CID 11951583
8-[4-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one (PubChem CID 11951583) has the molecular formula C23H28ClFN4O2 and a molecular weight of 446.95 g/mol. Its IUPAC name is 8-[4-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one.
| Compound Name | 8-[4-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one |
|---|---|
| PubChem CID | 11951583 |
| Molecular Formula | C23H28ClFN4O2 |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 8-[4-[4-(2-chloro-4-fluorophenyl)piperazin-1-yl]butoxy]-1,3,4,5-tetrahydro-1,3-benzodiazepin-2-one |
| SMILES | O=C1NCCc2ccc(OCCCCN3CCN(c4ccc(F)cc4Cl)CC3)cc2N1 |
| InChI | InChI=1S/C23H28ClFN4O2/c24-20-15-18(25)4-6-22(20)29-12-10-28(11-13-29)9-1-2-14-31-19-5-3-17-7-8-26-23(30)27-21(17)16-19/h3-6,15-16H,1-2,7-14H2,(H2,26,27,30) |
| InChIKey | IHHJJVXWZCVFJQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|