C13H22ClN3O — CID 119516110
N-(6-amino-3-pyridinyl)-3,5-dimethylhexanamide;hydrochloride (PubChem CID 119516110) has the molecular formula C13H22ClN3O and a molecular weight of 271.79 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-3,5-dimethylhexanamide;hydrochloride.
| Compound Name | N-(6-amino-3-pyridinyl)-3,5-dimethylhexanamide;hydrochloride |
|---|---|
| PubChem CID | 119516110 |
| Molecular Formula | C13H22ClN3O |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-3,5-dimethylhexanamide;hydrochloride |
| SMILES | CC(C)CC(C)CC(=O)Nc1ccc(N)nc1.Cl |
| InChI | InChI=1S/C13H21N3O.ClH/c1-9(2)6-10(3)7-13(17)16-11-4-5-12(14)15-8-11;/h4-5,8-10H,6-7H2,1-3H3,(H2,14,15)(H,16,17);1H |
| InChIKey | VEHOAYWQTBPZCT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |