About 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid
5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid (PubChem CID 11951626) has the molecular formula C29H32N2O3
and a molecular weight of 456.59 g/mol. Its IUPAC name is 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid |
| PubChem CID | 11951626 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid |
| SMILES | CCCc1c(OCc2cccc(-c3ccc(C(=O)O)nc3)c2)ccc2c1ccn2CC(C)(C)C |
| InChI | InChI=1S/C29H32N2O3/c1-5-7-24-23-14-15-31(19-29(2,3)4)26(23)12-13-27(24)34-18-20-8-6-9-21(16-20)22-10-11-25(28(32)33)30-17-22/h6,8-17H,5,7,18-19H2,1-4H3,(H,32,33) |
| InChIKey | MHJPJOMQLXOXMY-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid?
The IUPAC name of 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid (CID 11951626) is 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid?
The canonical SMILES for 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid is CCCc1c(OCc2cccc(-c3ccc(C(=O)O)nc3)c2)ccc2c1ccn2CC(C)(C)C.
What is the InChIKey of 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid?
The InChIKey is MHJPJOMQLXOXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32N2O3/c1-5-7-24-23-14-15-31(19-29(2,3)4)26(23)12-13-27(24)34-18-20-8-6-9-21(16-20)22-10-11-25(28(32)33)30-17-22/h6,8-17H,5,7,18-19H2,1-4H3,(H,32,33).
What are the key properties of 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid?
5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid has a molecular weight of 456.59 g/mol, XLogP of 6.98, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[[1-(2,2-dimethylpropyl)-4-propylindol-5-yl]oxymethyl]phenyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 11951626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).