C12H13N3O — CID 11951642
5-ethyl-1-oxido-7,8-dihydro-6H-cyclopenta[g][1,2,4]benzotriazin-1-ium (PubChem CID 11951642) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 5-ethyl-1-oxido-7,8-dihydro-6H-cyclopenta[g][1,2,4]benzotriazin-1-ium.
| Compound Name | 5-ethyl-1-oxido-7,8-dihydro-6H-cyclopenta[g][1,2,4]benzotriazin-1-ium |
|---|---|
| PubChem CID | 11951642 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 5-ethyl-1-oxido-7,8-dihydro-6H-cyclopenta[g][1,2,4]benzotriazin-1-ium |
| SMILES | CCc1c2c(cc3c1ncn[n+]3[O-])CCC2 |
| InChI | InChI=1S/C12H13N3O/c1-2-9-10-5-3-4-8(10)6-11-12(9)13-7-14-15(11)16/h6-7H,2-5H2,1H3 |
| InChIKey | DCZSEDUESKBPHM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|