C18H33N3O2 — CID 119517575
1-[3-[4-(1-aminoethyl)piperidine-1-carbonyl]piperidin-1-yl]-2-methylbutan-1-one (PubChem CID 119517575) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 1-[3-[4-(1-aminoethyl)piperidine-1-carbonyl]piperidin-1-yl]-2-methylbutan-1-one.
| Compound Name | 1-[3-[4-(1-aminoethyl)piperidine-1-carbonyl]piperidin-1-yl]-2-methylbutan-1-one |
|---|---|
| PubChem CID | 119517575 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 1-[3-[4-(1-aminoethyl)piperidine-1-carbonyl]piperidin-1-yl]-2-methylbutan-1-one |
| SMILES | CCC(C)C(=O)N1CCCC(C(=O)N2CCC(C(C)N)CC2)C1 |
| InChI | InChI=1S/C18H33N3O2/c1-4-13(2)17(22)21-9-5-6-16(12-21)18(23)20-10-7-15(8-11-20)14(3)19/h13-16H,4-12,19H2,1-3H3 |
| InChIKey | IVTSEOXOSCRWQG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |