C16H20ClFN2OS — CID 119518600
[4-(1-aminoethyl)piperidin-1-yl]-(5-fluoro-1-benzothiophen-2-yl)methanone;hydrochloride (PubChem CID 119518600) has the molecular formula C16H20ClFN2OS and a molecular weight of 342.87 g/mol. Its IUPAC name is [4-(1-aminoethyl)piperidin-1-yl]-(5-fluoro-1-benzothiophen-2-yl)methanone;hydrochloride.
| Compound Name | [4-(1-aminoethyl)piperidin-1-yl]-(5-fluoro-1-benzothiophen-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119518600 |
| Molecular Formula | C16H20ClFN2OS |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | [4-(1-aminoethyl)piperidin-1-yl]-(5-fluoro-1-benzothiophen-2-yl)methanone;hydrochloride |
| SMILES | CC(N)C1CCN(C(=O)c2cc3cc(F)ccc3s2)CC1.Cl |
| InChI | InChI=1S/C16H19FN2OS.ClH/c1-10(18)11-4-6-19(7-5-11)16(20)15-9-12-8-13(17)2-3-14(12)21-15;/h2-3,8-11H,4-7,18H2,1H3;1H |
| InChIKey | LBZWLGMFBQZPMU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |