C19H28N2O2 — CID 11951970
4,4-dimethyl-2-[3-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-5H-1,3-oxazole (PubChem CID 11951970) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 4,4-dimethyl-2-[3-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[3-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 11951970 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 4,4-dimethyl-2-[3-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-5H-1,3-oxazole |
| SMILES | CC1CCCN1CCCOc1cccc(C2=NC(C)(C)CO2)c1 |
| InChI | InChI=1S/C19H28N2O2/c1-15-7-5-10-21(15)11-6-12-22-17-9-4-8-16(13-17)18-20-19(2,3)14-23-18/h4,8-9,13,15H,5-7,10-12,14H2,1-3H3 |
| InChIKey | GSIMTKCWAPPTAI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|