C34H43N3O5 — CID 11951995
N-benzyl-2-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]acetamide (PubChem CID 11951995) has the molecular formula C34H43N3O5 and a molecular weight of 573.73 g/mol. Its IUPAC name is N-benzyl-2-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]acetamide.
| Compound Name | N-benzyl-2-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]acetamide |
|---|---|
| PubChem CID | 11951995 |
| Molecular Formula | C34H43N3O5 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | N-benzyl-2-[(2S,4R,5R)-4-(4-methoxyphenyl)-5-[[4-(3-methoxypropyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methoxy]piperidin-2-yl]acetamide |
| SMILES | COCCCN1CCOc2ccc(CO[C@H]3CN[C@H](CC(=O)NCc4ccccc4)C[C@@H]3c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C34H43N3O5/c1-39-17-6-15-37-16-18-41-32-14-9-26(19-31(32)37)24-42-33-23-35-28(20-30(33)27-10-12-29(40-2)13-11-27)21-34(38)36-22-25-7-4-3-5-8-25/h3-5,7-14,19,28,30,33,35H,6,15-18,20-24H2,1-2H3,(H,36,38)/t28-,30+,33-/m0/s1 |
| InChIKey | YAOWPZCKCBPYKB-HCJVQNJKSA-N |
| XLogP | 4.67 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|