C21H27ClN2OS — CID 119520631
[4-(1-aminoethyl)piperidin-1-yl]-[4-(phenylsulfanylmethyl)phenyl]methanone;hydrochloride (PubChem CID 119520631) has the molecular formula C21H27ClN2OS and a molecular weight of 390.98 g/mol. Its IUPAC name is [4-(1-aminoethyl)piperidin-1-yl]-[4-(phenylsulfanylmethyl)phenyl]methanone;hydrochloride.
| Compound Name | [4-(1-aminoethyl)piperidin-1-yl]-[4-(phenylsulfanylmethyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119520631 |
| Molecular Formula | C21H27ClN2OS |
| Molecular Weight | 390.98 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | [4-(1-aminoethyl)piperidin-1-yl]-[4-(phenylsulfanylmethyl)phenyl]methanone;hydrochloride |
| SMILES | CC(N)C1CCN(C(=O)c2ccc(CSc3ccccc3)cc2)CC1.Cl |
| InChI | InChI=1S/C21H26N2OS.ClH/c1-16(22)18-11-13-23(14-12-18)21(24)19-9-7-17(8-10-19)15-25-20-5-3-2-4-6-20;/h2-10,16,18H,11-15,22H2,1H3;1H |
| InChIKey | SLQLRCRAVZQSGF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.98 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |