C14H22BrClN2OS — CID 119520974
1-[4-(1-aminoethyl)piperidin-1-yl]-3-(4-bromothiophen-2-yl)propan-1-one;hydrochloride (PubChem CID 119520974) has the molecular formula C14H22BrClN2OS and a molecular weight of 381.77 g/mol. Its IUPAC name is 1-[4-(1-aminoethyl)piperidin-1-yl]-3-(4-bromothiophen-2-yl)propan-1-one;hydrochloride.
| Compound Name | 1-[4-(1-aminoethyl)piperidin-1-yl]-3-(4-bromothiophen-2-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119520974 |
| Molecular Formula | C14H22BrClN2OS |
| Molecular Weight | 381.77 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 1-[4-(1-aminoethyl)piperidin-1-yl]-3-(4-bromothiophen-2-yl)propan-1-one;hydrochloride |
| SMILES | CC(N)C1CCN(C(=O)CCc2cc(Br)cs2)CC1.Cl |
| InChI | InChI=1S/C14H21BrN2OS.ClH/c1-10(16)11-4-6-17(7-5-11)14(18)3-2-13-8-12(15)9-19-13;/h8-11H,2-7,16H2,1H3;1H |
| InChIKey | WNUPCFIAVWUUPB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |