C14H18Cl3N3O — CID 119522739
N-(1-amino-2-methylpropan-2-yl)-7-chloroquinoline-2-carboxamide;dihydrochloride (PubChem CID 119522739) has the molecular formula C14H18Cl3N3O and a molecular weight of 350.68 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-7-chloroquinoline-2-carboxamide;dihydrochloride.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-7-chloroquinoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119522739 |
| Molecular Formula | C14H18Cl3N3O |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-7-chloroquinoline-2-carboxamide;dihydrochloride |
| SMILES | CC(C)(CN)NC(=O)c1ccc2ccc(Cl)cc2n1.Cl.Cl |
| InChI | InChI=1S/C14H16ClN3O.2ClH/c1-14(2,8-16)18-13(19)11-6-4-9-3-5-10(15)7-12(9)17-11;;/h3-7H,8,16H2,1-2H3,(H,18,19);2*1H |
| InChIKey | SIDYQVFQMZBWQQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |