C13H28ClN3O2 — CID 119523411
N-[4-[(1-amino-2-methylpropan-2-yl)amino]-4-oxobutyl]-2,2-dimethylpropanamide;hydrochloride (PubChem CID 119523411) has the molecular formula C13H28ClN3O2 and a molecular weight of 293.84 g/mol. Its IUPAC name is N-[4-[(1-amino-2-methylpropan-2-yl)amino]-4-oxobutyl]-2,2-dimethylpropanamide;hydrochloride.
| Compound Name | N-[4-[(1-amino-2-methylpropan-2-yl)amino]-4-oxobutyl]-2,2-dimethylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119523411 |
| Molecular Formula | C13H28ClN3O2 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-[4-[(1-amino-2-methylpropan-2-yl)amino]-4-oxobutyl]-2,2-dimethylpropanamide;hydrochloride |
| SMILES | CC(C)(CN)NC(=O)CCCNC(=O)C(C)(C)C.Cl |
| InChI | InChI=1S/C13H27N3O2.ClH/c1-12(2,3)11(18)15-8-6-7-10(17)16-13(4,5)9-14;/h6-9,14H2,1-5H3,(H,15,18)(H,16,17);1H |
| InChIKey | HXJPEGZPOOPPAP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|