C11H25ClN2OS — CID 119524067
N-(1-amino-2-methylpropan-2-yl)-2-(3-methylbutylsulfanyl)acetamide;hydrochloride (PubChem CID 119524067) has the molecular formula C11H25ClN2OS and a molecular weight of 268.85 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-2-(3-methylbutylsulfanyl)acetamide;hydrochloride.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-2-(3-methylbutylsulfanyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119524067 |
| Molecular Formula | C11H25ClN2OS |
| Molecular Weight | 268.85 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-2-(3-methylbutylsulfanyl)acetamide;hydrochloride |
| SMILES | CC(C)CCSCC(=O)NC(C)(C)CN.Cl |
| InChI | InChI=1S/C11H24N2OS.ClH/c1-9(2)5-6-15-7-10(14)13-11(3,4)8-12;/h9H,5-8,12H2,1-4H3,(H,13,14);1H |
| InChIKey | TZDREAJYMVLVCK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.85 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|