C12H19ClN4O4 — CID 119525088
N-(1-amino-2-methylpropan-2-yl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide;hydrochloride (PubChem CID 119525088) has the molecular formula C12H19ClN4O4 and a molecular weight of 318.76 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide;hydrochloride.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119525088 |
| Molecular Formula | C12H19ClN4O4 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetamide;hydrochloride |
| SMILES | C=CCN1C(=O)C(=O)N(CC(=O)NC(C)(C)CN)C1=O.Cl |
| InChI | InChI=1S/C12H18N4O4.ClH/c1-4-5-15-9(18)10(19)16(11(15)20)6-8(17)14-12(2,3)7-13;/h4H,1,5-7,13H2,2-3H3,(H,14,17);1H |
| InChIKey | UQSWDVDOMGGPCP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|