C23H29N3O2 — CID 119526669
N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide (PubChem CID 119526669) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide.
| Compound Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 119526669 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzamide |
| SMILES | CC(C)c1ccc(C(N)CNC(=O)c2ccc(CN3CCCC3=O)cc2)cc1 |
| InChI | InChI=1S/C23H29N3O2/c1-16(2)18-9-11-19(12-10-18)21(24)14-25-23(28)20-7-5-17(6-8-20)15-26-13-3-4-22(26)27/h5-12,16,21H,3-4,13-15,24H2,1-2H3,(H,25,28) |
| InChIKey | NDTAFWHUWYFUHV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |