C19H25ClN4O3S — CID 119527156
N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide;hydrochloride (PubChem CID 119527156) has the molecular formula C19H25ClN4O3S and a molecular weight of 424.95 g/mol. Its IUPAC name is N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide;hydrochloride.
| Compound Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119527156 |
| Molecular Formula | C19H25ClN4O3S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide;hydrochloride |
| SMILES | CC(C)c1ccc(C(N)CNC(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)cc1.Cl |
| InChI | InChI=1S/C19H24N4O3S.ClH/c1-13(2)14-3-5-15(6-4-14)17(20)11-21-19(24)16-7-8-18-22-27(25,26)10-9-23(18)12-16;/h3-8,12-13,17H,9-11,20H2,1-2H3,(H,21,24);1H |
| InChIKey | BEIHMUOHBNINAE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |