C20H26N2O2S — CID 119527201
N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-(4-methoxyphenyl)sulfanylacetamide (PubChem CID 119527201) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-(4-methoxyphenyl)sulfanylacetamide.
| Compound Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-(4-methoxyphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 119527201 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-[2-amino-2-(4-propan-2-ylphenyl)ethyl]-2-(4-methoxyphenyl)sulfanylacetamide |
| SMILES | COc1ccc(SCC(=O)NCC(N)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H26N2O2S/c1-14(2)15-4-6-16(7-5-15)19(21)12-22-20(23)13-25-18-10-8-17(24-3)9-11-18/h4-11,14,19H,12-13,21H2,1-3H3,(H,22,23) |
| InChIKey | YTCVQTITUSFUIM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |