C15H26ClN3O4S — CID 119527625
N-(2-amino-2-phenylethyl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide;hydrochloride (PubChem CID 119527625) has the molecular formula C15H26ClN3O4S and a molecular weight of 379.91 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide;hydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119527625 |
| Molecular Formula | C15H26ClN3O4S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-2-(2-propan-2-yloxyethylsulfonylamino)acetamide;hydrochloride |
| SMILES | CC(C)OCCS(=O)(=O)NCC(=O)NCC(N)c1ccccc1.Cl |
| InChI | InChI=1S/C15H25N3O4S.ClH/c1-12(2)22-8-9-23(20,21)18-11-15(19)17-10-14(16)13-6-4-3-5-7-13;/h3-7,12,14,18H,8-11,16H2,1-2H3,(H,17,19);1H |
| InChIKey | NGRNEVLOXIPPEV-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |