C14H20Cl2N4O — CID 119527702
N-(2-amino-2-phenylethyl)-3-imidazol-1-ylpropanamide;dihydrochloride (PubChem CID 119527702) has the molecular formula C14H20Cl2N4O and a molecular weight of 331.25 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-3-imidazol-1-ylpropanamide;dihydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-3-imidazol-1-ylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119527702 |
| Molecular Formula | C14H20Cl2N4O |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-3-imidazol-1-ylpropanamide;dihydrochloride |
| SMILES | Cl.Cl.NC(CNC(=O)CCn1ccnc1)c1ccccc1 |
| InChI | InChI=1S/C14H18N4O.2ClH/c15-13(12-4-2-1-3-5-12)10-17-14(19)6-8-18-9-7-16-11-18;;/h1-5,7,9,11,13H,6,8,10,15H2,(H,17,19);2*1H |
| InChIKey | MMLVDIOPVKMLLE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |