C29H29Cl2IN4O3 — CID 11952782
(3S)-4-[(1R)-1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-1-(2-morpholin-4-ylethyl)-3H-1,4-benzodiazepine-2,5-dione (PubChem CID 11952782) has the molecular formula C29H29Cl2IN4O3 and a molecular weight of 679.39 g/mol. Its IUPAC name is (3S)-4-[(1R)-1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-1-(2-morpholin-4-ylethyl)-3H-1,4-benzodiazepine-2,5-dione.
| Compound Name | (3S)-4-[(1R)-1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-1-(2-morpholin-4-ylethyl)-3H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 11952782 |
| Molecular Formula | C29H29Cl2IN4O3 |
| Molecular Weight | 679.39 g/mol |
| Exact Mass | 678.07 |
| IUPAC Name | (3S)-4-[(1R)-1-(2-amino-4-chlorophenyl)ethyl]-3-(4-chlorophenyl)-7-iodo-1-(2-morpholin-4-ylethyl)-3H-1,4-benzodiazepine-2,5-dione |
| SMILES | C[C@H](c1ccc(Cl)cc1N)N1C(=O)c2cc(I)ccc2N(CCN2CCOCC2)C(=O)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H29Cl2IN4O3/c1-18(23-8-6-21(31)16-25(23)33)36-27(19-2-4-20(30)5-3-19)29(38)35(11-10-34-12-14-39-15-13-34)26-9-7-22(32)17-24(26)28(36)37/h2-9,16-18,27H,10-15,33H2,1H3/t18-,27+/m1/s1 |
| InChIKey | TXTIZPFXYRRDES-CLYVBNDRSA-N |
| XLogP | 5.80 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.39 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|