C15H24ClN3O2 — CID 119527853
N-(2-amino-2-phenylethyl)-N',N'-dimethylpentanediamide;hydrochloride (PubChem CID 119527853) has the molecular formula C15H24ClN3O2 and a molecular weight of 313.83 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-N',N'-dimethylpentanediamide;hydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-N',N'-dimethylpentanediamide;hydrochloride |
|---|---|
| PubChem CID | 119527853 |
| Molecular Formula | C15H24ClN3O2 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-N',N'-dimethylpentanediamide;hydrochloride |
| SMILES | CN(C)C(=O)CCCC(=O)NCC(N)c1ccccc1.Cl |
| InChI | InChI=1S/C15H23N3O2.ClH/c1-18(2)15(20)10-6-9-14(19)17-11-13(16)12-7-4-3-5-8-12;/h3-5,7-8,13H,6,9-11,16H2,1-2H3,(H,17,19);1H |
| InChIKey | NGHVUJFFVPQEAR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |