C25H27FN4O4S — CID 11952840
N-[[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamoyl]benzamide (PubChem CID 11952840) has the molecular formula C25H27FN4O4S and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamoyl]benzamide.
| Compound Name | N-[[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 11952840 |
| Molecular Formula | C25H27FN4O4S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-[[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamoyl]benzamide |
| SMILES | O=C(COCc1ccc(F)cc1)NCCCCCc1csc(NC(=O)NC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C25H27FN4O4S/c26-20-12-10-18(11-13-20)15-34-16-22(31)27-14-6-2-5-9-21-17-35-25(28-21)30-24(33)29-23(32)19-7-3-1-4-8-19/h1,3-4,7-8,10-13,17H,2,5-6,9,14-16H2,(H,27,31)(H2,28,29,30,32,33) |
| InChIKey | RKWDQHXSVVNDBP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|