C23H32FN5O3S — CID 11952844
2-[(4-fluorophenyl)methoxy]-N-[5-[2-(piperidin-4-ylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]acetamide (PubChem CID 11952844) has the molecular formula C23H32FN5O3S and a molecular weight of 477.61 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methoxy]-N-[5-[2-(piperidin-4-ylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methoxy]-N-[5-[2-(piperidin-4-ylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 11952844 |
| Molecular Formula | C23H32FN5O3S |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 2-[(4-fluorophenyl)methoxy]-N-[5-[2-(piperidin-4-ylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]acetamide |
| SMILES | O=C(COCc1ccc(F)cc1)NCCCCCc1csc(NC(=O)NC2CCNCC2)n1 |
| InChI | InChI=1S/C23H32FN5O3S/c24-18-7-5-17(6-8-18)14-32-15-21(30)26-11-3-1-2-4-20-16-33-23(28-20)29-22(31)27-19-9-12-25-13-10-19/h5-8,16,19,25H,1-4,9-15H2,(H,26,30)(H2,27,28,29,31) |
| InChIKey | FDLCWUNEIYFNAZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|