About N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide
N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide (PubChem CID 11952883) has the molecular formula C19H24FN3O3S
and a molecular weight of 393.48 g/mol. Its IUPAC name is N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide.
Molecular Properties
| Compound Name | N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide |
| PubChem CID | 11952883 |
| Molecular Formula | C19H24FN3O3S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide |
| SMILES | CC(=O)Nc1nc(CCCCCNC(=O)COCc2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C19H24FN3O3S/c1-14(24)22-19-23-17(13-27-19)5-3-2-4-10-21-18(25)12-26-11-15-6-8-16(20)9-7-15/h6-9,13H,2-5,10-12H2,1H3,(H,21,25)(H,22,23,24) |
| InChIKey | FHHYALDJVFUJKQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide?
The IUPAC name of N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide (CID 11952883) is N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide.
What is the SMILES notation for N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide?
The canonical SMILES for N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide is CC(=O)Nc1nc(CCCCCNC(=O)COCc2ccc(F)cc2)cs1.
What is the InChIKey of N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide?
The InChIKey is FHHYALDJVFUJKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24FN3O3S/c1-14(24)22-19-23-17(13-27-19)5-3-2-4-10-21-18(25)12-26-11-15-6-8-16(20)9-7-15/h6-9,13H,2-5,10-12H2,1H3,(H,21,25)(H,22,23,24).
What are the key properties of N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide?
N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide has a molecular weight of 393.48 g/mol, XLogP of 3.29, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2-acetamido-1,3-thiazol-4-yl)pentyl]-2-[(4-fluorophenyl)methoxy]acetamide is sourced from PubChem (CID 11952883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).