About phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate
phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 11952884) has the molecular formula C24H26FN3O4S
and a molecular weight of 471.55 g/mol. Its IUPAC name is phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate.
Molecular Properties
| Compound Name | phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate |
| PubChem CID | 11952884 |
| Molecular Formula | C24H26FN3O4S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | O=C(COCc1ccc(F)cc1)NCCCCCc1csc(NC(=O)Oc2ccccc2)n1 |
| InChI | InChI=1S/C24H26FN3O4S/c25-19-12-10-18(11-13-19)15-31-16-22(29)26-14-6-2-3-7-20-17-33-23(27-20)28-24(30)32-21-8-4-1-5-9-21/h1,4-5,8-13,17H,2-3,6-7,14-16H2,(H,26,29)(H,27,28,30) |
| InChIKey | RBZUSYSYLISCAX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate?
The IUPAC name of phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate (CID 11952884) is phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate.
What is the SMILES notation for phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate?
The canonical SMILES for phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate is O=C(COCc1ccc(F)cc1)NCCCCCc1csc(NC(=O)Oc2ccccc2)n1.
What is the InChIKey of phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate?
The InChIKey is RBZUSYSYLISCAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26FN3O4S/c25-19-12-10-18(11-13-19)15-31-16-22(29)26-14-6-2-3-7-20-17-33-23(27-20)28-24(30)32-21-8-4-1-5-9-21/h1,4-5,8-13,17H,2-3,6-7,14-16H2,(H,26,29)(H,27,28,30).
What are the key properties of phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate?
phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate has a molecular weight of 471.55 g/mol, XLogP of 4.94, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[4-[5-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]pentyl]-1,3-thiazol-2-yl]carbamate is sourced from PubChem (CID 11952884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).