C17H23Cl2N5O — CID 119529366
N-(2-amino-2-phenylethyl)-6-pyrrolidin-1-ylpyridazine-3-carboxamide;dihydrochloride (PubChem CID 119529366) has the molecular formula C17H23Cl2N5O and a molecular weight of 384.31 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-6-pyrrolidin-1-ylpyridazine-3-carboxamide;dihydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-6-pyrrolidin-1-ylpyridazine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119529366 |
| Molecular Formula | C17H23Cl2N5O |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-6-pyrrolidin-1-ylpyridazine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(CNC(=O)c1ccc(N2CCCC2)nn1)c1ccccc1 |
| InChI | InChI=1S/C17H21N5O.2ClH/c18-14(13-6-2-1-3-7-13)12-19-17(23)15-8-9-16(21-20-15)22-10-4-5-11-22;;/h1-3,6-9,14H,4-5,10-12,18H2,(H,19,23);2*1H |
| InChIKey | TWVBOYBFXRUKLS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |