C15H23N3O3S — CID 119530020
N-propyl-N-pyrrolidin-3-yl-4-(sulfamoylmethyl)benzamide (PubChem CID 119530020) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-propyl-N-pyrrolidin-3-yl-4-(sulfamoylmethyl)benzamide.
| Compound Name | N-propyl-N-pyrrolidin-3-yl-4-(sulfamoylmethyl)benzamide |
|---|---|
| PubChem CID | 119530020 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-propyl-N-pyrrolidin-3-yl-4-(sulfamoylmethyl)benzamide |
| SMILES | CCCN(C(=O)c1ccc(CS(N)(=O)=O)cc1)C1CCNC1 |
| InChI | InChI=1S/C15H23N3O3S/c1-2-9-18(14-7-8-17-10-14)15(19)13-5-3-12(4-6-13)11-22(16,20)21/h3-6,14,17H,2,7-11H2,1H3,(H2,16,20,21) |
| InChIKey | RTADRHDYPQVEAU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |