C20H14N2O2 — CID 11953130
3-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid (PubChem CID 11953130) has the molecular formula C20H14N2O2 and a molecular weight of 314.30 g/mol. Its IUPAC name is 3-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid.
| Compound Name | 3-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid |
|---|---|
| PubChem CID | 11953130 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-(5-phenyl-1H-pyrrolo[2,3-b]pyridin-3-yl)benzoic acid |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(NC=C3C4=CC(=CC=C4)C(=O)O)N=C2 |
| InChI | InChI=1S/C20H14N2O2/c23-20(24)15-8-4-7-14(9-15)18-12-22-19-17(18)10-16(11-21-19)13-5-2-1-3-6-13/h1-12H,(H,21,22)(H,23,24) |
| InChIKey | RKDPUWAQGCNFQQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | 449 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |