C16H19F7N6O2 — CID 11953154
1-[(2S)-2-amino-4-oxo-4-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butyl]-5,5-difluoropiperidin-2-one (PubChem CID 11953154) has the molecular formula C16H19F7N6O2 and a molecular weight of 460.35 g/mol. Its IUPAC name is 1-[(2S)-2-amino-4-oxo-4-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butyl]-5,5-difluoropiperidin-2-one.
| Compound Name | 1-[(2S)-2-amino-4-oxo-4-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butyl]-5,5-difluoropiperidin-2-one |
|---|---|
| PubChem CID | 11953154 |
| Molecular Formula | C16H19F7N6O2 |
| Molecular Weight | 460.35 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 1-[(2S)-2-amino-4-oxo-4-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butyl]-5,5-difluoropiperidin-2-one |
| SMILES | N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)C(F)(F)F)C1)CN1CC(F)(F)CCC1=O |
| InChI | InChI=1S/C16H19F7N6O2/c17-14(18)2-1-11(30)28(8-14)6-9(24)5-12(31)27-3-4-29-10(7-27)25-26-13(29)15(19,20)16(21,22)23/h9H,1-8,24H2/t9-/m0/s1 |
| InChIKey | IGENXLFHZMEIHQ-VIFPVBQESA-N |
| XLogP | 1.25 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|