C18H24ClN3O3S2 — CID 119531682
N-propyl-N-pyrrolidin-3-yl-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride (PubChem CID 119531682) has the molecular formula C18H24ClN3O3S2 and a molecular weight of 430.00 g/mol. Its IUPAC name is N-propyl-N-pyrrolidin-3-yl-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride.
| Compound Name | N-propyl-N-pyrrolidin-3-yl-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119531682 |
| Molecular Formula | C18H24ClN3O3S2 |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-propyl-N-pyrrolidin-3-yl-3-(thiophen-2-ylsulfonylamino)benzamide;hydrochloride |
| SMILES | CCCN(C(=O)c1cccc(NS(=O)(=O)c2cccs2)c1)C1CCNC1.Cl |
| InChI | InChI=1S/C18H23N3O3S2.ClH/c1-2-10-21(16-8-9-19-13-16)18(22)14-5-3-6-15(12-14)20-26(23,24)17-7-4-11-25-17;/h3-7,11-12,16,19-20H,2,8-10,13H2,1H3;1H |
| InChIKey | DEMOYNSWGADDFL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |