C16H21F5N6O3 — CID 11953204
(6S)-4-[(2S)-2-amino-4-oxo-4-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butyl]-6-methylmorpholin-3-one (PubChem CID 11953204) has the molecular formula C16H21F5N6O3 and a molecular weight of 440.37 g/mol. Its IUPAC name is (6S)-4-[(2S)-2-amino-4-oxo-4-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butyl]-6-methylmorpholin-3-one.
| Compound Name | (6S)-4-[(2S)-2-amino-4-oxo-4-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butyl]-6-methylmorpholin-3-one |
|---|---|
| PubChem CID | 11953204 |
| Molecular Formula | C16H21F5N6O3 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (6S)-4-[(2S)-2-amino-4-oxo-4-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butyl]-6-methylmorpholin-3-one |
| SMILES | C[C@H]1CN(C[C@@H](N)CC(=O)N2CCn3c(nnc3C(F)(F)C(F)(F)F)C2)C(=O)CO1 |
| InChI | InChI=1S/C16H21F5N6O3/c1-9-5-26(13(29)8-30-9)6-10(22)4-12(28)25-2-3-27-11(7-25)23-24-14(27)15(17,18)16(19,20)21/h9-10H,2-8,22H2,1H3/t9-,10-/m0/s1 |
| InChIKey | XMDWVNBJYMPVPT-UWVGGRQHSA-N |
| XLogP | 0.24 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|