C14H19NO4 — CID 11953312
tert-butyl (2S)-2-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]-2,5-dihydropyrrole-1-carboxylate (PubChem CID 11953312) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 11953312 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | tert-butyl (2S)-2-[(2R)-4-methyl-5-oxo-2H-furan-2-yl]-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC1=C[C@H]([C@@H]2C=CCN2C(=O)OC(C)(C)C)OC1=O |
| InChI | InChI=1S/C14H19NO4/c1-9-8-11(18-12(9)16)10-6-5-7-15(10)13(17)19-14(2,3)4/h5-6,8,10-11H,7H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | QIFZJZYUIKIPFV-WDEREUQCSA-N |
| XLogP | 2.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|