C23H25NO4 — CID 11953327
(7Z,9R,10R,10aR)-9,10-bis(phenylmethoxy)-1,5,6,9,10,10a-hexahydro-[1,3]oxazolo[3,4-a]azocin-3-one (PubChem CID 11953327) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is (7Z,9R,10R,10aR)-9,10-bis(phenylmethoxy)-1,5,6,9,10,10a-hexahydro-[1,3]oxazolo[3,4-a]azocin-3-one.
| Compound Name | (7Z,9R,10R,10aR)-9,10-bis(phenylmethoxy)-1,5,6,9,10,10a-hexahydro-[1,3]oxazolo[3,4-a]azocin-3-one |
|---|---|
| PubChem CID | 11953327 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (7Z,9R,10R,10aR)-9,10-bis(phenylmethoxy)-1,5,6,9,10,10a-hexahydro-[1,3]oxazolo[3,4-a]azocin-3-one |
| SMILES | O=C1OC[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)/C=C\CCN12 |
| InChI | InChI=1S/C23H25NO4/c25-23-24-14-8-7-13-21(26-15-18-9-3-1-4-10-18)22(20(24)17-28-23)27-16-19-11-5-2-6-12-19/h1-7,9-13,20-22H,8,14-17H2/b13-7-/t20-,21-,22-/m1/s1 |
| InChIKey | HXQFBMIULAFUBG-MBRVGIFSSA-N |
| XLogP | 3.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|