C32H35NO7 — CID 11953334
benzyl (1R,2R,6R,8S,9R,10R)-4,4-dimethyl-9,10-bis(phenylmethoxy)-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodecane-12-carboxylate (PubChem CID 11953334) has the molecular formula C32H35NO7 and a molecular weight of 545.63 g/mol. Its IUPAC name is benzyl (1R,2R,6R,8S,9R,10R)-4,4-dimethyl-9,10-bis(phenylmethoxy)-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodecane-12-carboxylate.
| Compound Name | benzyl (1R,2R,6R,8S,9R,10R)-4,4-dimethyl-9,10-bis(phenylmethoxy)-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodecane-12-carboxylate |
|---|---|
| PubChem CID | 11953334 |
| Molecular Formula | C32H35NO7 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | benzyl (1R,2R,6R,8S,9R,10R)-4,4-dimethyl-9,10-bis(phenylmethoxy)-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodecane-12-carboxylate |
| SMILES | CC1(C)O[C@H]2O[C@@H]3[C@H](OCc4ccccc4)[C@H](OCc4ccccc4)CN(C(=O)OCc4ccccc4)[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C32H35NO7/c1-32(2)39-29-26-28(38-30(29)40-32)27(36-20-23-14-8-4-9-15-23)25(35-19-22-12-6-3-7-13-22)18-33(26)31(34)37-21-24-16-10-5-11-17-24/h3-17,25-30H,18-21H2,1-2H3/t25-,26-,27-,28+,29-,30-/m1/s1 |
| InChIKey | GDXGYISFGWGGBM-STXXVOARSA-N |
| XLogP | 5.05 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |