C26H25NO12S — CID 11953363
[(2R,3S,4S)-4-[(2R)-2-amino-3-methoxy-3-oxopropyl]sulfanyl-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 11953363) has the molecular formula C26H25NO12S and a molecular weight of 575.55 g/mol. Its IUPAC name is [(2R,3S,4S)-4-[(2R)-2-amino-3-methoxy-3-oxopropyl]sulfanyl-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [(2R,3S,4S)-4-[(2R)-2-amino-3-methoxy-3-oxopropyl]sulfanyl-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 11953363 |
| Molecular Formula | C26H25NO12S |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 575.11 |
| IUPAC Name | [(2R,3S,4S)-4-[(2R)-2-amino-3-methoxy-3-oxopropyl]sulfanyl-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | COC(=O)[C@@H](N)CS[C@H]1c2c(O)cc(O)cc2O[C@H](c2ccc(O)c(O)c2)[C@@H]1OC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C26H25NO12S/c1-37-26(36)13(27)9-40-24-20-16(31)7-12(28)8-19(20)38-22(10-2-3-14(29)15(30)4-10)23(24)39-25(35)11-5-17(32)21(34)18(33)6-11/h2-8,13,22-24,28-34H,9,27H2,1H3/t13-,22+,23-,24-/m0/s1 |
| InChIKey | KSDQUTOKJKZHLF-FUZOOZNDSA-N |
| XLogP | 2.26 |
| TPSA | 229.46 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|