2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid

C7H10N2O2S — CID 11953490

IUPAC2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid
SMILESCC(C)Nc1nc(C(=O)O)cs1
InChIInChI=1S/C7H10N2O2S/c1-4(2)8-7-9-5(3-12-7)6(10)11/h3-4H,1-2H3,(H,8,9)(H,10,11)
InChIKeyHULGNRJQYKBQCC-UHFFFAOYSA-N
MW186.24 g/mol
LogP1.66
Rot. Bonds3

About 2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid

2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 11953490) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid
PubChem CID11953490
Molecular FormulaC7H10N2O2S
Molecular Weight186.24 g/mol
Exact Mass186.05
IUPAC Name2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid
SMILESCC(C)Nc1nc(C(=O)O)cs1
InChIInChI=1S/C7H10N2O2S/c1-4(2)8-7-9-5(3-12-7)6(10)11/h3-4H,1-2H3,(H,8,9)(H,10,11)
InChIKeyHULGNRJQYKBQCC-UHFFFAOYSA-N
XLogP1.66
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.24
LogP ≤ 51.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid (CID 11953490) is 2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid is CC(C)Nc1nc(C(=O)O)cs1.
What is the InChIKey of 2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid?
The InChIKey is HULGNRJQYKBQCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-4(2)8-7-9-5(3-12-7)6(10)11/h3-4H,1-2H3,(H,8,9)(H,10,11).
What are the key properties of 2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid?
2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid has a molecular weight of 186.24 g/mol, XLogP of 1.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propan-2-ylamino)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 11953490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).