About 3-amino-5-methoxyphenol
3-amino-5-methoxyphenol (PubChem CID 11953516) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 3-amino-5-methoxyphenol.
Molecular Properties
| Compound Name | 3-amino-5-methoxyphenol |
| PubChem CID | 11953516 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3-amino-5-methoxyphenol |
| SMILES | COc1cc(N)cc(O)c1 |
| InChI | InChI=1S/C7H9NO2/c1-10-7-3-5(8)2-6(9)4-7/h2-4,9H,8H2,1H3 |
| InChIKey | ILTCFIIXWWUIPC-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-methoxyphenol?
The IUPAC name of 3-amino-5-methoxyphenol (CID 11953516) is 3-amino-5-methoxyphenol.
What is the SMILES notation for 3-amino-5-methoxyphenol?
The canonical SMILES for 3-amino-5-methoxyphenol is COc1cc(N)cc(O)c1.
What is the InChIKey of 3-amino-5-methoxyphenol?
The InChIKey is ILTCFIIXWWUIPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-10-7-3-5(8)2-6(9)4-7/h2-4,9H,8H2,1H3.
What are the key properties of 3-amino-5-methoxyphenol?
3-amino-5-methoxyphenol has a molecular weight of 139.15 g/mol, XLogP of 0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-methoxyphenol is sourced from PubChem (CID 11953516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).