C16H24BrClN2O — CID 119535206
3-(4-bromo-3-methylphenyl)-N-(2-pyrrolidin-3-ylethyl)propanamide;hydrochloride (PubChem CID 119535206) has the molecular formula C16H24BrClN2O and a molecular weight of 375.74 g/mol. Its IUPAC name is 3-(4-bromo-3-methylphenyl)-N-(2-pyrrolidin-3-ylethyl)propanamide;hydrochloride.
| Compound Name | 3-(4-bromo-3-methylphenyl)-N-(2-pyrrolidin-3-ylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119535206 |
| Molecular Formula | C16H24BrClN2O |
| Molecular Weight | 375.74 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-(4-bromo-3-methylphenyl)-N-(2-pyrrolidin-3-ylethyl)propanamide;hydrochloride |
| SMILES | Cc1cc(CCC(=O)NCCC2CCNC2)ccc1Br.Cl |
| InChI | InChI=1S/C16H23BrN2O.ClH/c1-12-10-13(2-4-15(12)17)3-5-16(20)19-9-7-14-6-8-18-11-14;/h2,4,10,14,18H,3,5-9,11H2,1H3,(H,19,20);1H |
| InChIKey | MPLVKFOHZHMDGL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.74 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |