About (4R)-4,5-dimethylhex-5-en-2-one
(4R)-4,5-dimethylhex-5-en-2-one (PubChem CID 11953531) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is (4R)-4,5-dimethylhex-5-en-2-one.
Molecular Properties
| Compound Name | (4R)-4,5-dimethylhex-5-en-2-one |
| PubChem CID | 11953531 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (4R)-4,5-dimethylhex-5-en-2-one |
| SMILES | C=C(C)[C@H](C)CC(C)=O |
| InChI | InChI=1S/C8H14O/c1-6(2)7(3)5-8(4)9/h7H,1,5H2,2-4H3/t7-/m1/s1 |
| InChIKey | BDMMRMHHMFKXRU-SSDOTTSWSA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4,5-dimethylhex-5-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4,5-dimethylhex-5-en-2-one?
The IUPAC name of (4R)-4,5-dimethylhex-5-en-2-one (CID 11953531) is (4R)-4,5-dimethylhex-5-en-2-one.
What is the SMILES notation for (4R)-4,5-dimethylhex-5-en-2-one?
The canonical SMILES for (4R)-4,5-dimethylhex-5-en-2-one is C=C(C)[C@H](C)CC(C)=O.
What is the InChIKey of (4R)-4,5-dimethylhex-5-en-2-one?
The InChIKey is BDMMRMHHMFKXRU-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H14O/c1-6(2)7(3)5-8(4)9/h7H,1,5H2,2-4H3/t7-/m1/s1.
What are the key properties of (4R)-4,5-dimethylhex-5-en-2-one?
(4R)-4,5-dimethylhex-5-en-2-one has a molecular weight of 126.20 g/mol, XLogP of 2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4,5-dimethylhex-5-en-2-one is sourced from PubChem (CID 11953531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).