About (1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol
(1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol (PubChem CID 11953557) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is (1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol.
Analyze (1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol?
The IUPAC name of (1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol (CID 11953557) is (1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol.
What is the SMILES notation for (1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol?
The canonical SMILES for (1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol is C[C@@]12CCC[C@@]13CCC[C@@](O)(C2)O3.
What is the InChIKey of (1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol?
The InChIKey is VAVUZFPNOUWNGT-AXFHLTTASA-N. The full InChI is InChI=1S/C11H18O2/c1-9-4-2-5-10(9)6-3-7-11(12,8-9)13-10/h12H,2-8H2,1H3/t9-,10+,11-/m0/s1.
What are the key properties of (1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol?
(1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol has a molecular weight of 182.26 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S,7S)-5-methyl-11-oxatricyclo[5.3.1.01,5]undecan-7-ol is sourced from PubChem (CID 11953557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).