C19H29N3O3S — CID 119535630
1-(4-methylphenyl)sulfonyl-N-(2-pyrrolidin-3-ylethyl)piperidine-3-carboxamide (PubChem CID 119535630) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-N-(2-pyrrolidin-3-ylethyl)piperidine-3-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-N-(2-pyrrolidin-3-ylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119535630 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-N-(2-pyrrolidin-3-ylethyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)NCCC3CCNC3)C2)cc1 |
| InChI | InChI=1S/C19H29N3O3S/c1-15-4-6-18(7-5-15)26(24,25)22-12-2-3-17(14-22)19(23)21-11-9-16-8-10-20-13-16/h4-7,16-17,20H,2-3,8-14H2,1H3,(H,21,23) |
| InChIKey | XOKOZIUYHGNWBI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |