C13H19BrO5 — CID 11953578
(3aS,4Z,6R,6aS)-4-(bromomethylidene)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole (PubChem CID 11953578) has the molecular formula C13H19BrO5 and a molecular weight of 335.19 g/mol. Its IUPAC name is (3aS,4Z,6R,6aS)-4-(bromomethylidene)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole.
| Compound Name | (3aS,4Z,6R,6aS)-4-(bromomethylidene)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 11953578 |
| Molecular Formula | C13H19BrO5 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | (3aS,4Z,6R,6aS)-4-(bromomethylidene)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H]3COC(C)(C)O3)O/C(=C\Br)[C@H]2O1 |
| InChI | InChI=1S/C13H19BrO5/c1-12(2)15-6-8(17-12)9-11-10(7(5-14)16-9)18-13(3,4)19-11/h5,8-11H,6H2,1-4H3/b7-5-/t8-,9-,10-,11+/m1/s1 |
| InChIKey | QDWBWLUEKSKKQP-XXTMVKQCSA-N |
| XLogP | 2.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |