C13H12F3NO2S — CID 11953670
1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3,3,3-trifluoropropan-1-one (PubChem CID 11953670) has the molecular formula C13H12F3NO2S and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 11953670 |
| Molecular Formula | C13H12F3NO2S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 1-[(4S)-4-benzyl-2-sulfanylidene-1,3-oxazolidin-3-yl]-3,3,3-trifluoropropan-1-one |
| SMILES | O=C(CC(F)(F)F)N1C(=S)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C13H12F3NO2S/c14-13(15,16)7-11(18)17-10(8-19-12(17)20)6-9-4-2-1-3-5-9/h1-5,10H,6-8H2/t10-/m0/s1 |
| InChIKey | JTABJKAFYSXYSV-JTQLQIEISA-N |
| XLogP | 2.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|