C19H29N3O2S — CID 119536940
4-methylsulfanyl-2-[(2-phenylacetyl)amino]-N-(2-pyrrolidin-3-ylethyl)butanamide (PubChem CID 119536940) has the molecular formula C19H29N3O2S and a molecular weight of 363.53 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[(2-phenylacetyl)amino]-N-(2-pyrrolidin-3-ylethyl)butanamide.
| Compound Name | 4-methylsulfanyl-2-[(2-phenylacetyl)amino]-N-(2-pyrrolidin-3-ylethyl)butanamide |
|---|---|
| PubChem CID | 119536940 |
| Molecular Formula | C19H29N3O2S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 4-methylsulfanyl-2-[(2-phenylacetyl)amino]-N-(2-pyrrolidin-3-ylethyl)butanamide |
| SMILES | CSCCC(NC(=O)Cc1ccccc1)C(=O)NCCC1CCNC1 |
| InChI | InChI=1S/C19H29N3O2S/c1-25-12-9-17(19(24)21-11-8-16-7-10-20-14-16)22-18(23)13-15-5-3-2-4-6-15/h2-6,16-17,20H,7-14H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | AMCCFQNWATWRGE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |